C22H17N3O3 — CID 71881498
3-[(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)methyl]-N-phenylbenzamide (PubChem CID 71881498) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 3-[(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)methyl]-N-phenylbenzamide.
| Compound Name | 3-[(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 71881498 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-[(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)methyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(Cn2c(-c3ccccc3)noc2=O)c1 |
| InChI | InChI=1S/C22H17N3O3/c26-21(23-19-12-5-2-6-13-19)18-11-7-8-16(14-18)15-25-20(24-28-22(25)27)17-9-3-1-4-10-17/h1-14H,15H2,(H,23,26) |
| InChIKey | RZLBONKOCUCPCB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |