C34H42N4O4 — CID 14600065
N-[(2S)-1-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(naphthalen-1-ylmethyl)-5-phenoxypentanamide (PubChem CID 14600065) has the molecular formula C34H42N4O4 and a molecular weight of 570.73 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(naphthalen-1-ylmethyl)-5-phenoxypentanamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(naphthalen-1-ylmethyl)-5-phenoxypentanamide |
|---|---|
| PubChem CID | 14600065 |
| Molecular Formula | C34H42N4O4 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(naphthalen-1-ylmethyl)-5-phenoxypentanamide |
| SMILES | CC(C)C[C@@H](CO)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)C(CCCOc1ccccc1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C34H42N4O4/c1-24(2)18-29(22-39)37-34(41)32(20-28-21-35-23-36-28)38-33(40)27(13-9-17-42-30-14-4-3-5-15-30)19-26-12-8-11-25-10-6-7-16-31(25)26/h3-8,10-12,14-16,21,23-24,27,29,32,39H,9,13,17-20,22H2,1-2H3,(H,35,36)(H,37,41)(H,38,40)/t27?,29-,32-/m0/s1 |
| InChIKey | DJQVPKXVHNEMHJ-GJXOXSOYSA-N |
| XLogP | 4.83 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|