C34H40N4O4 — CID 57028760
N-[(4S,7S)-7-amino-8-(1H-imidazol-5-yl)-2-methyl-5,6-dioxooctan-4-yl]-2-(naphthalen-1-ylmethyl)-5-phenoxypentanamide (PubChem CID 57028760) has the molecular formula C34H40N4O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is N-[(4S,7S)-7-amino-8-(1H-imidazol-5-yl)-2-methyl-5,6-dioxooctan-4-yl]-2-(naphthalen-1-ylmethyl)-5-phenoxypentanamide.
| Compound Name | N-[(4S,7S)-7-amino-8-(1H-imidazol-5-yl)-2-methyl-5,6-dioxooctan-4-yl]-2-(naphthalen-1-ylmethyl)-5-phenoxypentanamide |
|---|---|
| PubChem CID | 57028760 |
| Molecular Formula | C34H40N4O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | N-[(4S,7S)-7-amino-8-(1H-imidazol-5-yl)-2-methyl-5,6-dioxooctan-4-yl]-2-(naphthalen-1-ylmethyl)-5-phenoxypentanamide |
| SMILES | CC(C)C[C@H](NC(=O)C(CCCOc1ccccc1)Cc1cccc2ccccc12)C(=O)C(=O)[C@@H](N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C34H40N4O4/c1-23(2)18-31(33(40)32(39)30(35)20-27-21-36-22-37-27)38-34(41)26(13-9-17-42-28-14-4-3-5-15-28)19-25-12-8-11-24-10-6-7-16-29(24)25/h3-8,10-12,14-16,21-23,26,30-31H,9,13,17-20,35H2,1-2H3,(H,36,37)(H,38,41)/t26?,30-,31-/m0/s1 |
| InChIKey | PSLIPCFYLIAOKH-GIMKPLNSSA-N |
| XLogP | 4.82 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|