C32H42N4O3 — CID 56622283
N-[(4S,7S)-7-amino-8-(1H-imidazol-5-yl)-2-methyl-5,6-dioxooctan-4-yl]-2-benzyl-7-phenylheptanamide (PubChem CID 56622283) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is N-[(4S,7S)-7-amino-8-(1H-imidazol-5-yl)-2-methyl-5,6-dioxooctan-4-yl]-2-benzyl-7-phenylheptanamide.
| Compound Name | N-[(4S,7S)-7-amino-8-(1H-imidazol-5-yl)-2-methyl-5,6-dioxooctan-4-yl]-2-benzyl-7-phenylheptanamide |
|---|---|
| PubChem CID | 56622283 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | N-[(4S,7S)-7-amino-8-(1H-imidazol-5-yl)-2-methyl-5,6-dioxooctan-4-yl]-2-benzyl-7-phenylheptanamide |
| SMILES | CC(C)C[C@H](NC(=O)C(CCCCCc1ccccc1)Cc1ccccc1)C(=O)C(=O)[C@@H](N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C32H42N4O3/c1-23(2)18-29(31(38)30(37)28(33)20-27-21-34-22-35-27)36-32(39)26(19-25-15-9-4-10-16-25)17-11-5-8-14-24-12-6-3-7-13-24/h3-4,6-7,9-10,12-13,15-16,21-23,26,28-29H,5,8,11,14,17-20,33H2,1-2H3,(H,34,35)(H,36,39)/t26?,28-,29-/m0/s1 |
| InChIKey | XESHGWHCWNHZOJ-DBESADCWSA-N |
| XLogP | 4.61 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|