C25H29N3O2 — CID 54331333
2-benzyl-N-[(2S)-1-(1H-imidazol-5-yl)-3-oxopropan-2-yl]-6-phenylhexanamide (PubChem CID 54331333) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-benzyl-N-[(2S)-1-(1H-imidazol-5-yl)-3-oxopropan-2-yl]-6-phenylhexanamide.
| Compound Name | 2-benzyl-N-[(2S)-1-(1H-imidazol-5-yl)-3-oxopropan-2-yl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 54331333 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-benzyl-N-[(2S)-1-(1H-imidazol-5-yl)-3-oxopropan-2-yl]-6-phenylhexanamide |
| SMILES | O=C[C@H](Cc1cnc[nH]1)NC(=O)C(CCCCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H29N3O2/c29-18-24(16-23-17-26-19-27-23)28-25(30)22(15-21-12-5-2-6-13-21)14-8-7-11-20-9-3-1-4-10-20/h1-6,9-10,12-13,17-19,22,24H,7-8,11,14-16H2,(H,26,27)(H,28,30)/t22?,24-/m0/s1 |
| InChIKey | MXRFASRYKHGQRL-GITCGBDTSA-N |
| XLogP | 3.91 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|