C29H33N5O2 — CID 14600113
N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(naphthalen-1-ylmethyl)-6-phenylhexanamide (PubChem CID 14600113) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(naphthalen-1-ylmethyl)-6-phenylhexanamide.
| Compound Name | N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(naphthalen-1-ylmethyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 14600113 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-2-(naphthalen-1-ylmethyl)-6-phenylhexanamide |
| SMILES | NNC(=O)[C@H](Cc1cnc[nH]1)NC(=O)C(CCCCc1ccccc1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C29H33N5O2/c30-34-29(36)27(18-25-19-31-20-32-25)33-28(35)24(13-5-4-11-21-9-2-1-3-10-21)17-23-15-8-14-22-12-6-7-16-26(22)23/h1-3,6-10,12,14-16,19-20,24,27H,4-5,11,13,17-18,30H2,(H,31,32)(H,33,35)(H,34,36)/t24?,27-/m0/s1 |
| InChIKey | RMVOJDAMXLDCBU-WKDCXCOVSA-N |
| XLogP | 3.85 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|