C32H25FN2O3 — CID 146000748
3-[[6-[5-fluoro-1-[(3-methoxyphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid (PubChem CID 146000748) has the molecular formula C32H25FN2O3 and a molecular weight of 504.56 g/mol. Its IUPAC name is 3-[[6-[5-fluoro-1-[(3-methoxyphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[6-[5-fluoro-1-[(3-methoxyphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 146000748 |
| Molecular Formula | C32H25FN2O3 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 3-[[6-[5-fluoro-1-[(3-methoxyphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid |
| SMILES | COc1cccc(Cn2ccc3cc(F)c(-c4ccc5ccn(Cc6cccc(C(=O)O)c6)c5c4)cc32)c1 |
| InChI | InChI=1S/C32H25FN2O3/c1-38-27-7-3-5-22(15-27)20-35-13-11-25-16-29(33)28(18-31(25)35)24-9-8-23-10-12-34(30(23)17-24)19-21-4-2-6-26(14-21)32(36)37/h2-18H,19-20H2,1H3,(H,36,37) |
| InChIKey | VMDWOLUVDRASFP-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 56.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |