C14H12F2O3 — CID 146004367
6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 146004367) has the molecular formula C14H12F2O3 and a molecular weight of 266.24 g/mol. Its IUPAC name is 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 146004367 |
| Molecular Formula | C14H12F2O3 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H12F2O3/c15-11-6-5-8(7-12(11)16)13(17)9-3-1-2-4-10(9)14(18)19/h1-2,5-7,9-10H,3-4H2,(H,18,19) |
| InChIKey | SEISVCBUJWEPMW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|