6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid

C14H12F2O3 — CID 146004367

IUPAC6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid
SMILESO=C(O)C1CC=CCC1C(=O)c1ccc(F)c(F)c1
InChIInChI=1S/C14H12F2O3/c15-11-6-5-8(7-12(11)16)13(17)9-3-1-2-4-10(9)14(18)19/h1-2,5-7,9-10H,3-4H2,(H,18,19)
InChIKeySEISVCBUJWEPMW-UHFFFAOYSA-N
MW266.24 g/mol
LogP2.81
Rot. Bonds3

About 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid

6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 146004367) has the molecular formula C14H12F2O3 and a molecular weight of 266.24 g/mol. Its IUPAC name is 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid.

Molecular Properties

Compound Name6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid
PubChem CID146004367
Molecular FormulaC14H12F2O3
Molecular Weight266.24 g/mol
Exact Mass266.08
IUPAC Name6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid
SMILESO=C(O)C1CC=CCC1C(=O)c1ccc(F)c(F)c1
InChIInChI=1S/C14H12F2O3/c15-11-6-5-8(7-12(11)16)13(17)9-3-1-2-4-10(9)14(18)19/h1-2,5-7,9-10H,3-4H2,(H,18,19)
InChIKeySEISVCBUJWEPMW-UHFFFAOYSA-N
XLogP2.81
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.24
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid (CID 146004367) is 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid is O=C(O)C1CC=CCC1C(=O)c1ccc(F)c(F)c1.
What is the InChIKey of 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid?
The InChIKey is SEISVCBUJWEPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2O3/c15-11-6-5-8(7-12(11)16)13(17)9-3-1-2-4-10(9)14(18)19/h1-2,5-7,9-10H,3-4H2,(H,18,19).
What are the key properties of 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid?
6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid has a molecular weight of 266.24 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-difluorobenzoyl)cyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 146004367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).