C18H22O5 — CID 10925192
(1R,6S)-6-(3,4-diethoxybenzoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 10925192) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (1R,6S)-6-(3,4-diethoxybenzoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-(3,4-diethoxybenzoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 10925192 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (1R,6S)-6-(3,4-diethoxybenzoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCOc1ccc(C(=O)C2CC=CC[C@H]2C(=O)O)cc1OCC |
| InChI | InChI=1S/C18H22O5/c1-3-22-15-10-9-12(11-16(15)23-4-2)17(19)13-7-5-6-8-14(13)18(20)21/h5-6,9-11,13-14H,3-4,7-8H2,1-2H3,(H,20,21)/t13?,14-/m1/s1 |
| InChIKey | ZIEHHMHQKCVKAW-ARLHGKGLSA-N |
| XLogP | 3.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|