C17H25NO3 — CID 116557438
(4-aminocyclohexyl)-(3,4-diethoxyphenyl)methanone (PubChem CID 116557438) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (4-aminocyclohexyl)-(3,4-diethoxyphenyl)methanone.
| Compound Name | (4-aminocyclohexyl)-(3,4-diethoxyphenyl)methanone |
|---|---|
| PubChem CID | 116557438 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (4-aminocyclohexyl)-(3,4-diethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)C2CCC(N)CC2)cc1OCC |
| InChI | InChI=1S/C17H25NO3/c1-3-20-15-10-7-13(11-16(15)21-4-2)17(19)12-5-8-14(18)9-6-12/h7,10-12,14H,3-6,8-9,18H2,1-2H3 |
| InChIKey | CJRBPNPHDJWIDR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |