C19H28O3 — CID 82550226
cyclohexyl-(3,4-dipropoxyphenyl)methanone (PubChem CID 82550226) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is cyclohexyl-(3,4-dipropoxyphenyl)methanone.
| Compound Name | cyclohexyl-(3,4-dipropoxyphenyl)methanone |
|---|---|
| PubChem CID | 82550226 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | cyclohexyl-(3,4-dipropoxyphenyl)methanone |
| SMILES | CCCOc1ccc(C(=O)C2CCCCC2)cc1OCCC |
| InChI | InChI=1S/C19H28O3/c1-3-12-21-17-11-10-16(14-18(17)22-13-4-2)19(20)15-8-6-5-7-9-15/h10-11,14-15H,3-9,12-13H2,1-2H3 |
| InChIKey | AVZIZQJXGZWNKV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |