C12H5F9O4 — CID 146004605
2,2,3,3,4,4-hexafluoro-5-oxo-5-[2-(trifluoromethoxy)phenyl]pentanoic acid (PubChem CID 146004605) has the molecular formula C12H5F9O4 and a molecular weight of 384.15 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-oxo-5-[2-(trifluoromethoxy)phenyl]pentanoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-oxo-5-[2-(trifluoromethoxy)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 146004605 |
| Molecular Formula | C12H5F9O4 |
| Molecular Weight | 384.15 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-oxo-5-[2-(trifluoromethoxy)phenyl]pentanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C12H5F9O4/c13-9(14,11(17,18)10(15,16)8(23)24)7(22)5-3-1-2-4-6(5)25-12(19,20)21/h1-4H,(H,23,24) |
| InChIKey | MFNAFIZEBHUOHS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.15 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|