C17H13BN2O2 — CID 146014442
(9-phenylpyrido[2,3-b]indol-2-yl)boronic acid (PubChem CID 146014442) has the molecular formula C17H13BN2O2 and a molecular weight of 288.12 g/mol. Its IUPAC name is (9-phenylpyrido[2,3-b]indol-2-yl)boronic acid.
| Compound Name | (9-phenylpyrido[2,3-b]indol-2-yl)boronic acid |
|---|---|
| PubChem CID | 146014442 |
| Molecular Formula | C17H13BN2O2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (9-phenylpyrido[2,3-b]indol-2-yl)boronic acid |
| SMILES | OB(O)c1ccc2c3ccccc3n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C17H13BN2O2/c21-18(22)16-11-10-14-13-8-4-5-9-15(13)20(17(14)19-16)12-6-2-1-3-7-12/h1-11,21-22H |
| InChIKey | KKFSDFPVGQQYKO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|