C27H23N3O — CID 146018607
4-[[4-(5H-chromeno[2,3-b]pyridin-5-yl)phenyl]iminomethyl]-N,N-dimethylaniline (PubChem CID 146018607) has the molecular formula C27H23N3O and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-[[4-(5H-chromeno[2,3-b]pyridin-5-yl)phenyl]iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(5H-chromeno[2,3-b]pyridin-5-yl)phenyl]iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 146018607 |
| Molecular Formula | C27H23N3O |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 4-[[4-(5H-chromeno[2,3-b]pyridin-5-yl)phenyl]iminomethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/c2ccc(C3c4ccccc4Oc4ncccc43)cc2)cc1 |
| InChI | InChI=1S/C27H23N3O/c1-30(2)22-15-9-19(10-16-22)18-29-21-13-11-20(12-14-21)26-23-6-3-4-8-25(23)31-27-24(26)7-5-17-28-27/h3-18,26H,1-2H3/b29-18+ |
| InChIKey | UGCZRNCIKLKFCL-RDRPBHBLSA-N |
| XLogP | 6.18 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|