C9H7N3 — CID 146019751
4H-pyrido[1,2-a]pyrimidine-2-carbonitrile (PubChem CID 146019751) has the molecular formula C9H7N3 and a molecular weight of 157.18 g/mol. Its IUPAC name is 4H-pyrido[1,2-a]pyrimidine-2-carbonitrile.
| Compound Name | 4H-pyrido[1,2-a]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 146019751 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 4H-pyrido[1,2-a]pyrimidine-2-carbonitrile |
| SMILES | N#CC1=CCN2C=CC=CC2=N1 |
| InChI | InChI=1S/C9H7N3/c10-7-8-4-6-12-5-2-1-3-9(12)11-8/h1-5H,6H2 |
| InChIKey | KWUHOYYDWKNYAM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |