C15H26O3Si — CID 146019799
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopenta-1,3-dien-1-yl]methyl acetate (PubChem CID 146019799) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopenta-1,3-dien-1-yl]methyl acetate.
| Compound Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopenta-1,3-dien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 146019799 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopenta-1,3-dien-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C(CO[Si](C)(C)C(C)(C)C)C=CC1 |
| InChI | InChI=1S/C15H26O3Si/c1-12(16)17-10-13-8-7-9-14(13)11-18-19(5,6)15(2,3)4/h7,9H,8,10-11H2,1-6H3 |
| InChIKey | UTEGINFIJKYROF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|