C14H16O3 — CID 146020417
methyl (2S,5Z)-4-oxospiro[bicyclo[5.2.1]deca-5,8-diene-10,1'-cyclopropane]-2-carboxylate (PubChem CID 146020417) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (2S,5Z)-4-oxospiro[bicyclo[5.2.1]deca-5,8-diene-10,1'-cyclopropane]-2-carboxylate.
| Compound Name | methyl (2S,5Z)-4-oxospiro[bicyclo[5.2.1]deca-5,8-diene-10,1'-cyclopropane]-2-carboxylate |
|---|---|
| PubChem CID | 146020417 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | methyl (2S,5Z)-4-oxospiro[bicyclo[5.2.1]deca-5,8-diene-10,1'-cyclopropane]-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC(=O)/C=C\C2C=CC1C21CC1 |
| InChI | InChI=1S/C14H16O3/c1-17-13(16)11-8-10(15)4-2-9-3-5-12(11)14(9)6-7-14/h2-5,9,11-12H,6-8H2,1H3/b4-2-/t9?,11-,12?/m0/s1 |
| InChIKey | NALPBIHGCHBKTD-KIHCUCEUSA-N |
| XLogP | 1.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|