C26H25N3O2S — CID 146021168
ethyl 5-cyano-6-cyclohex-2-en-1-ylsulfanyl-2-phenyl-4-pyridin-3-yl-1,4-dihydropyridine-3-carboxylate (PubChem CID 146021168) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is ethyl 5-cyano-6-cyclohex-2-en-1-ylsulfanyl-2-phenyl-4-pyridin-3-yl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 5-cyano-6-cyclohex-2-en-1-ylsulfanyl-2-phenyl-4-pyridin-3-yl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 146021168 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | ethyl 5-cyano-6-cyclohex-2-en-1-ylsulfanyl-2-phenyl-4-pyridin-3-yl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)NC(SC2C=CCCC2)=C(C#N)C1c1cccnc1 |
| InChI | InChI=1S/C26H25N3O2S/c1-2-31-26(30)23-22(19-12-9-15-28-17-19)21(16-27)25(32-20-13-7-4-8-14-20)29-24(23)18-10-5-3-6-11-18/h3,5-7,9-13,15,17,20,22,29H,2,4,8,14H2,1H3 |
| InChIKey | PKGKHWZZJLUWGB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|