C16H22ClN3O3 — CID 146021727
tert-butyl 3-[(2-pyridin-1-ium-1-ylacetyl)hydrazinylidene]cyclobutane-1-carboxylate chloride (PubChem CID 146021727) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is tert-butyl 3-[(2-pyridin-1-ium-1-ylacetyl)hydrazinylidene]cyclobutane-1-carboxylate chloride.
| Compound Name | tert-butyl 3-[(2-pyridin-1-ium-1-ylacetyl)hydrazinylidene]cyclobutane-1-carboxylate chloride |
|---|---|
| PubChem CID | 146021727 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | tert-butyl 3-[(2-pyridin-1-ium-1-ylacetyl)hydrazinylidene]cyclobutane-1-carboxylate chloride |
| SMILES | CC(C)(C)OC(=O)C1CC(=NNC(=O)C[n+]2ccccc2)C1.[Cl-] |
| InChI | InChI=1S/C16H21N3O3.ClH/c1-16(2,3)22-15(21)12-9-13(10-12)17-18-14(20)11-19-7-5-4-6-8-19;/h4-8,12H,9-11H2,1-3H3;1H/b17-13-; |
| InChIKey | CTPGCDAKKBQKOT-VSORCOHTSA-N |
| XLogP | -1.80 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|