C16H23ClN4O3 — CID 146021715
tert-butyl (3E)-3-[(2-pyridin-1-ium-1-ylacetyl)hydrazinylidene]pyrrolidine-1-carboxylate chloride (PubChem CID 146021715) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is tert-butyl (3E)-3-[(2-pyridin-1-ium-1-ylacetyl)hydrazinylidene]pyrrolidine-1-carboxylate chloride.
| Compound Name | tert-butyl (3E)-3-[(2-pyridin-1-ium-1-ylacetyl)hydrazinylidene]pyrrolidine-1-carboxylate chloride |
|---|---|
| PubChem CID | 146021715 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | tert-butyl (3E)-3-[(2-pyridin-1-ium-1-ylacetyl)hydrazinylidene]pyrrolidine-1-carboxylate chloride |
| SMILES | CC(C)(C)OC(=O)N1CC/C(=N\NC(=O)C[n+]2ccccc2)C1.[Cl-] |
| InChI | InChI=1S/C16H22N4O3.ClH/c1-16(2,3)23-15(22)20-10-7-13(11-20)17-18-14(21)12-19-8-5-4-6-9-19;/h4-6,8-9H,7,10-12H2,1-3H3;1H/b17-13+; |
| InChIKey | YOVVLLQCXGEWBK-IWSIBTJSSA-N |
| XLogP | -1.91 |
| TPSA | 74.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|