C17H22N3O2+ — CID 159027527
tert-butyl 1-phenyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-1-ium-5-carboxylate (PubChem CID 159027527) has the molecular formula C17H22N3O2+ and a molecular weight of 300.38 g/mol. Its IUPAC name is tert-butyl 1-phenyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-1-ium-5-carboxylate.
| Compound Name | tert-butyl 1-phenyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 159027527 |
| Molecular Formula | C17H22N3O2+ |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | tert-butyl 1-phenyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-1-ium-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c([nH]c[n+]2-c2ccccc2)C1 |
| InChI | InChI=1S/C17H21N3O2/c1-17(2,3)22-16(21)19-10-9-15-14(11-19)18-12-20(15)13-7-5-4-6-8-13/h4-8,12H,9-11H2,1-3H3/p+1 |
| InChIKey | KGZHDRIKOALFBV-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 49.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|