C19H22FN2O4+ — CID 134603126
tert-butyl 2-(4-fluorophenoxy)-1-hydroxy-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carboxylate (PubChem CID 134603126) has the molecular formula C19H22FN2O4+ and a molecular weight of 361.39 g/mol. Its IUPAC name is tert-butyl 2-(4-fluorophenoxy)-1-hydroxy-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carboxylate.
| Compound Name | tert-butyl 2-(4-fluorophenoxy)-1-hydroxy-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carboxylate |
|---|---|
| PubChem CID | 134603126 |
| Molecular Formula | C19H22FN2O4+ |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | tert-butyl 2-(4-fluorophenoxy)-1-hydroxy-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(ccc(Oc3ccc(F)cc3)[n+]2O)C1 |
| InChI | InChI=1S/C19H22FN2O4/c1-19(2,3)26-18(23)21-11-10-16-13(12-21)4-9-17(22(16)24)25-15-7-5-14(20)6-8-15/h4-9,24H,10-12H2,1-3H3/q+1 |
| InChIKey | AAFUZYLCCKGTGJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|