C21H23F2N3O4 — CID 121446916
tert-butyl 4-[2-fluoro-6-(4-fluorophenoxy)pyridine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 121446916) has the molecular formula C21H23F2N3O4 and a molecular weight of 419.43 g/mol. Its IUPAC name is tert-butyl 4-[2-fluoro-6-(4-fluorophenoxy)pyridine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-fluoro-6-(4-fluorophenoxy)pyridine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 121446916 |
| Molecular Formula | C21H23F2N3O4 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | tert-butyl 4-[2-fluoro-6-(4-fluorophenoxy)pyridine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2ccc(Oc3ccc(F)cc3)nc2F)CC1 |
| InChI | InChI=1S/C21H23F2N3O4/c1-21(2,3)30-20(28)26-12-10-25(11-13-26)19(27)16-8-9-17(24-18(16)23)29-15-6-4-14(22)5-7-15/h4-9H,10-13H2,1-3H3 |
| InChIKey | GDXYMTTUUMKLOW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|