C13H18N2O3 — CID 11334192
tert-butyl 1-oxido-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carboxylate (PubChem CID 11334192) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is tert-butyl 1-oxido-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carboxylate.
| Compound Name | tert-butyl 1-oxido-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carboxylate |
|---|---|
| PubChem CID | 11334192 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | tert-butyl 1-oxido-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(ccc[n+]2[O-])C1 |
| InChI | InChI=1S/C13H18N2O3/c1-13(2,3)18-12(16)14-8-6-11-10(9-14)5-4-7-15(11)17/h4-5,7H,6,8-9H2,1-3H3 |
| InChIKey | BIRVUIMEJLHEBT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|