C19H16N4O4S — CID 146022828
1-[4-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-ylsulfonyl)phenyl]pyrrolidine-2,5-dione (PubChem CID 146022828) has the molecular formula C19H16N4O4S and a molecular weight of 396.43 g/mol. Its IUPAC name is 1-[4-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-ylsulfonyl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-ylsulfonyl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146022828 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-[4-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-ylsulfonyl)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1ccc(S(=O)(=O)N2CCn3c2nc2ccccc23)cc1 |
| InChI | InChI=1S/C19H16N4O4S/c24-17-9-10-18(25)23(17)13-5-7-14(8-6-13)28(26,27)22-12-11-21-16-4-2-1-3-15(16)20-19(21)22/h1-8H,9-12H2 |
| InChIKey | KBYFHXHFJYBBGZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|