C19H18N4O4S — CID 86272936
1-[4-[[(4S)-2-amino-4-phenyl-4,5-dihydroimidazol-1-yl]sulfonyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 86272936) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 1-[4-[[(4S)-2-amino-4-phenyl-4,5-dihydroimidazol-1-yl]sulfonyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[[(4S)-2-amino-4-phenyl-4,5-dihydroimidazol-1-yl]sulfonyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 86272936 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[4-[[(4S)-2-amino-4-phenyl-4,5-dihydroimidazol-1-yl]sulfonyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | NC1=N[C@@H](c2ccccc2)CN1S(=O)(=O)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C19H18N4O4S/c20-19-21-16(13-4-2-1-3-5-13)12-22(19)28(26,27)15-8-6-14(7-9-15)23-17(24)10-11-18(23)25/h1-9,16H,10-12H2,(H2,20,21)/t16-/m1/s1 |
| InChIKey | RAQDCKZZWDYZSV-MRXNPFEDSA-N |
| XLogP | 1.40 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|