About 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one
4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one (PubChem CID 146024362) has the molecular formula C16H18N4O2S
and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one |
| PubChem CID | 146024362 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(C2CN(C(=O)c3ccc4ncsc4c3)C2)CC1=O |
| InChI | InChI=1S/C16H18N4O2S/c1-18-4-5-19(9-15(18)21)12-7-20(8-12)16(22)11-2-3-13-14(6-11)23-10-17-13/h2-3,6,10,12H,4-5,7-9H2,1H3 |
| InChIKey | ZNYYUVNGBTUGBO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one?
The IUPAC name of 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one (CID 146024362) is 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one.
What is the SMILES notation for 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one?
The canonical SMILES for 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one is CN1CCN(C2CN(C(=O)c3ccc4ncsc4c3)C2)CC1=O.
What is the InChIKey of 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one?
The InChIKey is ZNYYUVNGBTUGBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2S/c1-18-4-5-19(9-15(18)21)12-7-20(8-12)16(22)11-2-3-13-14(6-11)23-10-17-13/h2-3,6,10,12H,4-5,7-9H2,1H3.
What are the key properties of 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one?
4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one has a molecular weight of 330.41 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(1,3-benzothiazole-6-carbonyl)azetidin-3-yl]-1-methylpiperazin-2-one is sourced from PubChem (CID 146024362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).