C14H18N4O5S — CID 146025477
1-[2-[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethyl]pyrimidine-2,4-dione (PubChem CID 146025477) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is 1-[2-[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 146025477 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-[2-[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethyl]pyrimidine-2,4-dione |
| SMILES | CC1(C)OCC(CSc2nnc(CCn3ccc(=O)[nH]c3=O)o2)O1 |
| InChI | InChI=1S/C14H18N4O5S/c1-14(2)21-7-9(23-14)8-24-13-17-16-11(22-13)4-6-18-5-3-10(19)15-12(18)20/h3,5,9H,4,6-8H2,1-2H3,(H,15,19,20) |
| InChIKey | ZNOGUGZFDQOJAA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |