C19H15NO — CID 146025937
(4R)-4-naphthalen-2-yl-2-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 146025937) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is (4R)-4-naphthalen-2-yl-2-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-naphthalen-2-yl-2-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 146025937 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (4R)-4-naphthalen-2-yl-2-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(C2=N[C@H](c3ccc4ccccc4c3)CO2)cc1 |
| InChI | InChI=1S/C19H15NO/c1-2-7-15(8-3-1)19-20-18(13-21-19)17-11-10-14-6-4-5-9-16(14)12-17/h1-12,18H,13H2/t18-/m0/s1 |
| InChIKey | RPQRGQGEMAJIPE-SFHVURJKSA-N |
| XLogP | 4.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |