C20H24N4O — CID 146028195
(E)-N-(diaminomethylidene)-3-[3-[4-[(dimethylamino)methyl]phenyl]phenyl]-2-methylprop-2-enamide (PubChem CID 146028195) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[3-[4-[(dimethylamino)methyl]phenyl]phenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[3-[4-[(dimethylamino)methyl]phenyl]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 146028195 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[3-[4-[(dimethylamino)methyl]phenyl]phenyl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cccc(-c2ccc(CN(C)C)cc2)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C20H24N4O/c1-14(19(25)23-20(21)22)11-16-5-4-6-18(12-16)17-9-7-15(8-10-17)13-24(2)3/h4-12H,13H2,1-3H3,(H4,21,22,23,25)/b14-11+ |
| InChIKey | FEPHEUWFFDDOOQ-SDNWHVSQSA-N |
| XLogP | 2.62 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|