C23H21N3O3 — CID 76705078
3-[2,4-bis(3-hydroxyphenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide (PubChem CID 76705078) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[2,4-bis(3-hydroxyphenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide.
| Compound Name | 3-[2,4-bis(3-hydroxyphenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 76705078 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-[2,4-bis(3-hydroxyphenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
| SMILES | CC(=Cc1ccc(-c2cccc(O)c2)cc1-c1cccc(O)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C23H21N3O3/c1-14(22(29)26-23(24)25)10-18-9-8-16(15-4-2-6-19(27)11-15)13-21(18)17-5-3-7-20(28)12-17/h2-13,27-28H,1H3,(H4,24,25,26,29) |
| InChIKey | GSDKAAUZVFHABA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|