C19H19N3O2 — CID 51347696
(E)-3-[2-(4-acetylphenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide (PubChem CID 51347696) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (E)-3-[2-(4-acetylphenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide.
| Compound Name | (E)-3-[2-(4-acetylphenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 51347696 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (E)-3-[2-(4-acetylphenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
| SMILES | CC(=O)c1ccc(-c2ccccc2/C=C(\C)C(=O)N=C(N)N)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-12(18(24)22-19(20)21)11-16-5-3-4-6-17(16)15-9-7-14(8-10-15)13(2)23/h3-11H,1-2H3,(H4,20,21,22,24)/b12-11+ |
| InChIKey | NBYUXEKEACSTBG-VAWYXSNFSA-N |
| XLogP | 2.76 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|