C18H18FN5O — CID 76705022
3-[2-(4-carbamimidoyl-3-fluorophenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide (PubChem CID 76705022) has the molecular formula C18H18FN5O and a molecular weight of 339.37 g/mol. Its IUPAC name is 3-[2-(4-carbamimidoyl-3-fluorophenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide.
| Compound Name | 3-[2-(4-carbamimidoyl-3-fluorophenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 76705022 |
| Molecular Formula | C18H18FN5O |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-[2-(4-carbamimidoyl-3-fluorophenyl)phenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccccc2C=C(C)C(=O)N=C(N)N)cc1F |
| InChI | InChI=1S/C18H18FN5O/c1-10(17(25)24-18(22)23)8-11-4-2-3-5-13(11)12-6-7-14(16(20)21)15(19)9-12/h2-9H,1H3,(H3,20,21)(H4,22,23,24,25) |
| InChIKey | APWKUVZRQYJARS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|