C19H20FN5O — CID 75628334
3-[2-(4-carbamimidoyl-3-fluorophenyl)-4-methylphenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide (PubChem CID 75628334) has the molecular formula C19H20FN5O and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-[2-(4-carbamimidoyl-3-fluorophenyl)-4-methylphenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide.
| Compound Name | 3-[2-(4-carbamimidoyl-3-fluorophenyl)-4-methylphenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 75628334 |
| Molecular Formula | C19H20FN5O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-[2-(4-carbamimidoyl-3-fluorophenyl)-4-methylphenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2cc(C)ccc2C=C(C)C(=O)N=C(N)N)cc1F |
| InChI | InChI=1S/C19H20FN5O/c1-10-3-4-12(8-11(2)18(26)25-19(23)24)15(7-10)13-5-6-14(17(21)22)16(20)9-13/h3-9H,1-2H3,(H3,21,22)(H4,23,24,25,26) |
| InChIKey | UCMXIVAVSMFHQK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|