C22H17FN2O2 — CID 143784128
N-[amino-(3-fluoro-4-formylphenyl)methylidene]-4-(2-methylphenyl)benzamide (PubChem CID 143784128) has the molecular formula C22H17FN2O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[amino-(3-fluoro-4-formylphenyl)methylidene]-4-(2-methylphenyl)benzamide.
| Compound Name | N-[amino-(3-fluoro-4-formylphenyl)methylidene]-4-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 143784128 |
| Molecular Formula | C22H17FN2O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[amino-(3-fluoro-4-formylphenyl)methylidene]-4-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1-c1ccc(C(=O)/N=C(\N)c2ccc(C=O)c(F)c2)cc1 |
| InChI | InChI=1S/C22H17FN2O2/c1-14-4-2-3-5-19(14)15-6-8-16(9-7-15)22(27)25-21(24)17-10-11-18(13-26)20(23)12-17/h2-13H,1H3,(H2,24,25,27) |
| InChIKey | VICHDFPBDQNFOD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|