C20H31ClN4OSSi — CID 146029497
1-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methyl]-3-(3-chloro-4-cyano-2-methylphenyl)thiourea (PubChem CID 146029497) has the molecular formula C20H31ClN4OSSi and a molecular weight of 439.10 g/mol. Its IUPAC name is 1-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methyl]-3-(3-chloro-4-cyano-2-methylphenyl)thiourea.
| Compound Name | 1-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methyl]-3-(3-chloro-4-cyano-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 146029497 |
| Molecular Formula | C20H31ClN4OSSi |
| Molecular Weight | 439.10 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methyl]-3-(3-chloro-4-cyano-2-methylphenyl)thiourea |
| SMILES | Cc1c(NC(=S)NC[C@H]2NCC[C@@H]2O[Si](C)(C)C(C)(C)C)ccc(C#N)c1Cl |
| InChI | InChI=1S/C20H31ClN4OSSi/c1-13-15(8-7-14(11-22)18(13)21)25-19(27)24-12-16-17(9-10-23-16)26-28(5,6)20(2,3)4/h7-8,16-17,23H,9-10,12H2,1-6H3,(H2,24,25,27)/t16-,17+/m1/s1 |
| InChIKey | DZTNKOVGQPIPIQ-SJORKVTESA-N |
| XLogP | 4.56 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.10 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|