C21H30ClN3O2Si — CID 146028818
4-[(7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile (PubChem CID 146028818) has the molecular formula C21H30ClN3O2Si and a molecular weight of 420.03 g/mol. Its IUPAC name is 4-[(7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile.
| Compound Name | 4-[(7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile |
|---|---|
| PubChem CID | 146028818 |
| Molecular Formula | C21H30ClN3O2Si |
| Molecular Weight | 420.03 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[(7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3-methylbenzonitrile |
| SMILES | Cc1c(N2C[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CCN3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C21H30ClN3O2Si/c1-14-16(9-8-15(12-23)18(14)22)24-13-21(5)17(10-11-25(21)19(24)26)27-28(6,7)20(2,3)4/h8-9,17H,10-11,13H2,1-7H3/t17-,21+/m0/s1 |
| InChIKey | FYVKYEYGAVGPDG-LAUBAEHRSA-N |
| XLogP | 5.31 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.03 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|