C22H30ClN3O3Si — CID 125499187
4-[(5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-2-chloro-3-methylbenzonitrile (PubChem CID 125499187) has the molecular formula C22H30ClN3O3Si and a molecular weight of 448.04 g/mol. Its IUPAC name is 4-[(5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-2-chloro-3-methylbenzonitrile.
| Compound Name | 4-[(5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-2-chloro-3-methylbenzonitrile |
|---|---|
| PubChem CID | 125499187 |
| Molecular Formula | C22H30ClN3O3Si |
| Molecular Weight | 448.04 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-[(5S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-2-chloro-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)N(C)[C@]3(CCC[C@H]3O[Si](C)(C)C(C)(C)C)C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C22H30ClN3O3Si/c1-14-16(11-10-15(13-24)18(14)23)26-19(27)22(25(5)20(26)28)12-8-9-17(22)29-30(6,7)21(2,3)4/h10-11,17H,8-9,12H2,1-7H3/t17-,22+/m1/s1 |
| InChIKey | XGGBFAZYMOJUMD-VGSWGCGISA-N |
| XLogP | 5.23 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.04 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|