C17H18ClN3O2 — CID 118462010
2-chloro-4-(9-ethyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-methylbenzonitrile (PubChem CID 118462010) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-chloro-4-(9-ethyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-(9-ethyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 118462010 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-chloro-4-(9-ethyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-methylbenzonitrile |
| SMILES | CCC1CCCC12NC(=O)N(c1ccc(C#N)c(Cl)c1C)C2=O |
| InChI | InChI=1S/C17H18ClN3O2/c1-3-12-5-4-8-17(12)15(22)21(16(23)20-17)13-7-6-11(9-19)14(18)10(13)2/h6-7,12H,3-5,8H2,1-2H3,(H,20,23) |
| InChIKey | PKEUVONZZJFOOU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|