C19H19ClN4O2 — CID 71736965
2-chloro-4-[1-(3-cyanopropyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile (PubChem CID 71736965) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-chloro-4-[1-(3-cyanopropyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[1-(3-cyanopropyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 71736965 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-chloro-4-[1-(3-cyanopropyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)N(CCCC#N)C3(CCCC3)C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C19H19ClN4O2/c1-13-15(7-6-14(12-22)16(13)20)24-17(25)19(8-2-3-9-19)23(18(24)26)11-5-4-10-21/h6-7H,2-5,8-9,11H2,1H3 |
| InChIKey | IHIKKHPXWZVTDB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|