C13H12ClN3O2 — CID 118179027
2-chloro-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-methylbenzonitrile (PubChem CID 118179027) has the molecular formula C13H12ClN3O2 and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-chloro-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 118179027 |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-chloro-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)NC(C)(C)C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C13H12ClN3O2/c1-7-9(5-4-8(6-15)10(7)14)17-11(18)13(2,3)16-12(17)19/h4-5H,1-3H3,(H,16,19) |
| InChIKey | PWGYPPMJPHFWLV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|