C17H15BrF3N3S — CID 146037795
5-phenyl-3-[[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 146037795) has the molecular formula C17H15BrF3N3S and a molecular weight of 430.29 g/mol. Its IUPAC name is 5-phenyl-3-[[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1,3-thiazol-3-ium-2-amine bromide.
| Compound Name | 5-phenyl-3-[[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1,3-thiazol-3-ium-2-amine bromide |
|---|---|
| PubChem CID | 146037795 |
| Molecular Formula | C17H15BrF3N3S |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 5-phenyl-3-[[4-(trifluoromethyl)phenyl]methylideneamino]-4,5-dihydro-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | NC1=[N+](N=Cc2ccc(C(F)(F)F)cc2)CC(c2ccccc2)S1.[Br-] |
| InChI | InChI=1S/C17H14F3N3S.BrH/c18-17(19,20)14-8-6-12(7-9-14)10-22-23-11-15(24-16(23)21)13-4-2-1-3-5-13;/h1-10,15,21H,11H2;1H |
| InChIKey | FYVITDOYTNRQCC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|