C16H12F5N3S — CID 168612894
benzyl N'-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612894) has the molecular formula C16H12F5N3S and a molecular weight of 373.35 g/mol. Its IUPAC name is benzyl N'-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612894 |
| Molecular Formula | C16H12F5N3S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | benzyl N'-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(F)c(C(F)(F)F)c(F)c1)SCc1ccccc1 |
| InChI | InChI=1S/C16H12F5N3S/c17-12-6-11(7-13(18)14(12)16(19,20)21)8-23-24-15(22)25-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,22,24) |
| InChIKey | RNMZMRZWCNAPMU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|