C16H15FN3S+ — CID 139088834
(5S)-3-[(E)-(4-fluorophenyl)methylideneamino]-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-2-amine (PubChem CID 139088834) has the molecular formula C16H15FN3S+ and a molecular weight of 300.38 g/mol. Its IUPAC name is (5S)-3-[(E)-(4-fluorophenyl)methylideneamino]-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-2-amine.
| Compound Name | (5S)-3-[(E)-(4-fluorophenyl)methylideneamino]-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 139088834 |
| Molecular Formula | C16H15FN3S+ |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (5S)-3-[(E)-(4-fluorophenyl)methylideneamino]-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-2-amine |
| SMILES | NC1=[N+](/N=C/c2ccc(F)cc2)C[C@H](c2ccccc2)S1 |
| InChI | InChI=1S/C16H14FN3S/c17-14-8-6-12(7-9-14)10-19-20-11-15(21-16(20)18)13-4-2-1-3-5-13/h1-10,15,18H,11H2/p+1/b19-10+/t15-/m1/s1 |
| InChIKey | RPHVEWPXUMDHSX-GDXCHIGESA-O |
| XLogP | 2.97 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|