C15H11F2N3S — CID 11141209
2,4-bis(4-fluorophenyl)-2H-1,3,5-thiadiazin-6-amine (PubChem CID 11141209) has the molecular formula C15H11F2N3S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2,4-bis(4-fluorophenyl)-2H-1,3,5-thiadiazin-6-amine.
| Compound Name | 2,4-bis(4-fluorophenyl)-2H-1,3,5-thiadiazin-6-amine |
|---|---|
| PubChem CID | 11141209 |
| Molecular Formula | C15H11F2N3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2,4-bis(4-fluorophenyl)-2H-1,3,5-thiadiazin-6-amine |
| SMILES | NC1=NC(c2ccc(F)cc2)=NC(c2ccc(F)cc2)S1 |
| InChI | InChI=1S/C15H11F2N3S/c16-11-5-1-9(2-6-11)13-19-14(21-15(18)20-13)10-3-7-12(17)8-4-10/h1-8,14H,(H2,18,19,20) |
| InChIKey | VDKOYANMMRPPDK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |