C12H16ClN5O2 — CID 146038735
(3S,8aS)-2-(5-chloro-1-methyl-1,2,4-triazole-3-carbonyl)-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 146038735) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is (3S,8aS)-2-(5-chloro-1-methyl-1,2,4-triazole-3-carbonyl)-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3S,8aS)-2-(5-chloro-1-methyl-1,2,4-triazole-3-carbonyl)-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 146038735 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3S,8aS)-2-(5-chloro-1-methyl-1,2,4-triazole-3-carbonyl)-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | C[C@H]1C(=O)N2CCC[C@H]2CN1C(=O)c1nc(Cl)n(C)n1 |
| InChI | InChI=1S/C12H16ClN5O2/c1-7-10(19)17-5-3-4-8(17)6-18(7)11(20)9-14-12(13)16(2)15-9/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | MOIKFVYWNMPYRU-YUMQZZPRSA-N |
| XLogP | 0.30 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |