C19H18N4O2S — CID 146039206
(3aS,6aS)-5-(1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one (PubChem CID 146039206) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is (3aS,6aS)-5-(1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one.
| Compound Name | (3aS,6aS)-5-(1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 146039206 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3aS,6aS)-5-(1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
| SMILES | Cn1nc(-c2ccccc2)c2cc(C(=O)N3C[C@@H]4CC(=O)N[C@@H]4C3)sc21 |
| InChI | InChI=1S/C19H18N4O2S/c1-22-19-13(17(21-22)11-5-3-2-4-6-11)8-15(26-19)18(25)23-9-12-7-16(24)20-14(12)10-23/h2-6,8,12,14H,7,9-10H2,1H3,(H,20,24)/t12-,14+/m0/s1 |
| InChIKey | XJDUHJCODSQSCD-GXTWGEPZSA-N |
| XLogP | 2.26 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |