C19H19N3O4S — CID 146045900
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 146045900) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 146045900 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccccc2)c2cc(C(=O)N[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4O)sc21 |
| InChI | InChI=1S/C19H19N3O4S/c1-22-19-11(15(21-22)10-5-3-2-4-6-10)7-14(27-19)18(24)20-12-8-25-17-13(23)9-26-16(12)17/h2-7,12-13,16-17,23H,8-9H2,1H3,(H,20,24)/t12-,13-,16-,17-/m1/s1 |
| InChIKey | VVTVTKLXFGXLIZ-BQGCOEIASA-N |
| XLogP | 1.56 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |