C22H21N3OS — CID 56522692
N-(1,1-diphenylethyl)-1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 56522692) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is N-(1,1-diphenylethyl)-1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-(1,1-diphenylethyl)-1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 56522692 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-(1,1-diphenylethyl)-1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c2sc(C(=O)NC(C)(c3ccccc3)c3ccccc3)cc12 |
| InChI | InChI=1S/C22H21N3OS/c1-15-18-14-19(27-21(18)25(3)24-15)20(26)23-22(2,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-14H,1-3H3,(H,23,26) |
| InChIKey | XMQGBFYXEIKFFM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |