C33H41N7O3S — CID 157013499
17-(3-methylbutyl)-7-(1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carbonyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione (PubChem CID 157013499) has the molecular formula C33H41N7O3S and a molecular weight of 615.80 g/mol. Its IUPAC name is 17-(3-methylbutyl)-7-(1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carbonyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione.
| Compound Name | 17-(3-methylbutyl)-7-(1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carbonyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
|---|---|
| PubChem CID | 157013499 |
| Molecular Formula | C33H41N7O3S |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | 17-(3-methylbutyl)-7-(1-methyl-3-phenylthieno[3,2-d]pyrazole-5-carbonyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
| SMILES | CC(C)CCn1nc2c3c1CCC(C3)NC(=O)CCCN(C(=O)c1cc3c(-c4ccccc4)nn(C)c3s1)CCCNC2=O |
| InChI | InChI=1S/C33H41N7O3S/c1-21(2)14-18-40-26-13-12-23-19-24(26)30(37-40)31(42)34-15-8-17-39(16-7-11-28(41)35-23)32(43)27-20-25-29(22-9-5-4-6-10-22)36-38(3)33(25)44-27/h4-6,9-10,20-21,23H,7-8,11-19H2,1-3H3,(H,34,42)(H,35,41) |
| InChIKey | GNCDEYUOXGRNGX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |